C26H19ClN2O4 — CID 91113113
2-[2-chloro-3-hydroxy-6-(pyridin-2-ylmethylamino)-9H-xanthen-9-yl]benzoic acid (PubChem CID 91113113) has the molecular formula C26H19ClN2O4 and a molecular weight of 458.90 g/mol. Its IUPAC name is 2-[2-chloro-3-hydroxy-6-(pyridin-2-ylmethylamino)-9H-xanthen-9-yl]benzoic acid.
| Compound Name | 2-[2-chloro-3-hydroxy-6-(pyridin-2-ylmethylamino)-9H-xanthen-9-yl]benzoic acid |
|---|---|
| PubChem CID | 91113113 |
| Molecular Formula | C26H19ClN2O4 |
| Molecular Weight | 458.90 g/mol |
| Exact Mass | 458.10 |
| IUPAC Name | 2-[2-chloro-3-hydroxy-6-(pyridin-2-ylmethylamino)-9H-xanthen-9-yl]benzoic acid |
| SMILES | O=C(O)c1ccccc1C1c2ccc(NCc3ccccn3)cc2Oc2cc(O)c(Cl)cc21 |
| InChI | InChI=1S/C26H19ClN2O4/c27-21-12-20-24(13-22(21)30)33-23-11-15(29-14-16-5-3-4-10-28-16)8-9-19(23)25(20)17-6-1-2-7-18(17)26(31)32/h1-13,25,29-30H,14H2,(H,31,32) |
| InChIKey | QMDICGQWKHODKD-UHFFFAOYSA-N |
| XLogP | 6.04 |
| TPSA | 91.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.90 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |