C22H20N2O3 — CID 90993350
2-[3,6-bis(methylamino)-9H-xanthen-9-yl]benzoic acid (PubChem CID 90993350) has the molecular formula C22H20N2O3 and a molecular weight of 360.41 g/mol. Its IUPAC name is 2-[3,6-bis(methylamino)-9H-xanthen-9-yl]benzoic acid.
| Compound Name | 2-[3,6-bis(methylamino)-9H-xanthen-9-yl]benzoic acid |
|---|---|
| PubChem CID | 90993350 |
| Molecular Formula | C22H20N2O3 |
| Molecular Weight | 360.41 g/mol |
| Exact Mass | 360.15 |
| IUPAC Name | 2-[3,6-bis(methylamino)-9H-xanthen-9-yl]benzoic acid |
| SMILES | CNc1ccc2c(c1)Oc1cc(NC)ccc1C2c1ccccc1C(=O)O |
| InChI | InChI=1S/C22H20N2O3/c1-23-13-7-9-17-19(11-13)27-20-12-14(24-2)8-10-18(20)21(17)15-5-3-4-6-16(15)22(25)26/h3-12,21,23-24H,1-2H3,(H,25,26) |
| InChIKey | BBVNODMYYNVHSA-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.41 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_F(14)', 'substructure': 'N/A'} |
|---|