C22H15BrFNO6 — CID 89277975
3-[(2-bromo-2-fluoroacetyl)amino]-2-(3,6-dihydroxy-4aH-xanthen-9-yl)benzoic acid (PubChem CID 89277975) has the molecular formula C22H15BrFNO6 and a molecular weight of 488.27 g/mol. Its IUPAC name is 3-[(2-bromo-2-fluoroacetyl)amino]-2-(3,6-dihydroxy-4aH-xanthen-9-yl)benzoic acid.
| Compound Name | 3-[(2-bromo-2-fluoroacetyl)amino]-2-(3,6-dihydroxy-4aH-xanthen-9-yl)benzoic acid |
|---|---|
| PubChem CID | 89277975 |
| Molecular Formula | C22H15BrFNO6 |
| Molecular Weight | 488.27 g/mol |
| Exact Mass | 487.01 |
| IUPAC Name | 3-[(2-bromo-2-fluoroacetyl)amino]-2-(3,6-dihydroxy-4aH-xanthen-9-yl)benzoic acid |
| SMILES | O=C(O)c1cccc(NC(=O)C(F)Br)c1C1=C2C=CC(O)=CC2Oc2cc(O)ccc21 |
| InChI | InChI=1S/C22H15BrFNO6/c23-20(24)21(28)25-15-3-1-2-14(22(29)30)19(15)18-12-6-4-10(26)8-16(12)31-17-9-11(27)5-7-13(17)18/h1-9,16,20,26-27H,(H,25,28)(H,29,30) |
| InChIKey | JBGKDNCCYGTHCL-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 116.09 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.27 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|