C25H22N2O6S — CID 59993934
2-(6-hydroxy-3-oxo-4,4a-dihydroxanthen-9-yl)-5-(4-oxobutylcarbamothioylamino)benzoic acid (PubChem CID 59993934) has the molecular formula C25H22N2O6S and a molecular weight of 478.53 g/mol. Its IUPAC name is 2-(6-hydroxy-3-oxo-4,4a-dihydroxanthen-9-yl)-5-(4-oxobutylcarbamothioylamino)benzoic acid.
| Compound Name | 2-(6-hydroxy-3-oxo-4,4a-dihydroxanthen-9-yl)-5-(4-oxobutylcarbamothioylamino)benzoic acid |
|---|---|
| PubChem CID | 59993934 |
| Molecular Formula | C25H22N2O6S |
| Molecular Weight | 478.53 g/mol |
| Exact Mass | 478.12 |
| IUPAC Name | 2-(6-hydroxy-3-oxo-4,4a-dihydroxanthen-9-yl)-5-(4-oxobutylcarbamothioylamino)benzoic acid |
| SMILES | O=CCCCNC(=S)Nc1ccc(C2=C3C=CC(=O)CC3Oc3cc(O)ccc32)c(C(=O)O)c1 |
| InChI | InChI=1S/C25H22N2O6S/c28-10-2-1-9-26-25(34)27-14-3-6-17(20(11-14)24(31)32)23-18-7-4-15(29)12-21(18)33-22-13-16(30)5-8-19(22)23/h3-8,10-12,22,29H,1-2,9,13H2,(H,31,32)(H2,26,27,34) |
| InChIKey | UTJYLMQFJCWHLT-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 124.96 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.53 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|