C27H19N3O8S2 — CID 53371608
2-(3-hydroxy-6-oxoxanthen-9-yl)-5-[(4-sulfamoyloxyphenyl)carbamothioylamino]benzoic acid (PubChem CID 53371608) has the molecular formula C27H19N3O8S2 and a molecular weight of 577.60 g/mol. Its IUPAC name is 2-(3-hydroxy-6-oxoxanthen-9-yl)-5-[(4-sulfamoyloxyphenyl)carbamothioylamino]benzoic acid.
| Compound Name | 2-(3-hydroxy-6-oxoxanthen-9-yl)-5-[(4-sulfamoyloxyphenyl)carbamothioylamino]benzoic acid |
|---|---|
| PubChem CID | 53371608 |
| Molecular Formula | C27H19N3O8S2 |
| Molecular Weight | 577.60 g/mol |
| Exact Mass | 577.06 |
| IUPAC Name | 2-(3-hydroxy-6-oxoxanthen-9-yl)-5-[(4-sulfamoyloxyphenyl)carbamothioylamino]benzoic acid |
| SMILES | NS(=O)(=O)Oc1ccc(NC(=S)Nc2ccc(-c3c4ccc(=O)cc-4oc4cc(O)ccc34)c(C(=O)O)c2)cc1 |
| InChI | InChI=1S/C27H19N3O8S2/c28-40(35,36)38-18-6-1-14(2-7-18)29-27(39)30-15-3-8-19(22(11-15)26(33)34)25-20-9-4-16(31)12-23(20)37-24-13-17(32)5-10-21(24)25/h1-13,31H,(H,33,34)(H2,28,35,36)(H2,29,30,39) |
| InChIKey | WMEKKDCKNSFPTC-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 181.19 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.60 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|