C34H26N4O9S3 — CID 11216333
2-(3-hydroxy-6-oxoxanthen-9-yl)-5-[[4-[(4-sulfamoylphenyl)methylsulfamoyl]phenyl]carbamothioylamino]benzoic acid (PubChem CID 11216333) has the molecular formula C34H26N4O9S3 and a molecular weight of 730.80 g/mol. Its IUPAC name is 2-(3-hydroxy-6-oxoxanthen-9-yl)-5-[[4-[(4-sulfamoylphenyl)methylsulfamoyl]phenyl]carbamothioylamino]benzoic acid.
| Compound Name | 2-(3-hydroxy-6-oxoxanthen-9-yl)-5-[[4-[(4-sulfamoylphenyl)methylsulfamoyl]phenyl]carbamothioylamino]benzoic acid |
|---|---|
| PubChem CID | 11216333 |
| Molecular Formula | C34H26N4O9S3 |
| Molecular Weight | 730.80 g/mol |
| Exact Mass | 730.09 |
| IUPAC Name | 2-(3-hydroxy-6-oxoxanthen-9-yl)-5-[[4-[(4-sulfamoylphenyl)methylsulfamoyl]phenyl]carbamothioylamino]benzoic acid |
| SMILES | NS(=O)(=O)c1ccc(CNS(=O)(=O)c2ccc(NC(=S)Nc3ccc(-c4c5ccc(=O)cc-5oc5cc(O)ccc45)c(C(=O)O)c3)cc2)cc1 |
| InChI | InChI=1S/C34H26N4O9S3/c35-49(43,44)24-8-1-19(2-9-24)18-36-50(45,46)25-10-3-20(4-11-25)37-34(48)38-21-5-12-26(29(15-21)33(41)42)32-27-13-6-22(39)16-30(27)47-31-17-23(40)7-14-28(31)32/h1-17,36,39H,18H2,(H,41,42)(H2,35,43,44)(H2,37,38,48) |
| InChIKey | XQXLDTMLIZQSJA-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 218.13 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 730.80 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|