C25H28N3O4+ — CID 171100374
5-carbamoyl-2-[6-(dimethylamino)-3H-xanthen-9-yl]benzoic acid;dimethylazanium (PubChem CID 171100374) has the molecular formula C25H28N3O4+ and a molecular weight of 434.52 g/mol. Its IUPAC name is 5-carbamoyl-2-[6-(dimethylamino)-3H-xanthen-9-yl]benzoic acid;dimethylazanium.
| Compound Name | 5-carbamoyl-2-[6-(dimethylamino)-3H-xanthen-9-yl]benzoic acid;dimethylazanium |
|---|---|
| PubChem CID | 171100374 |
| Molecular Formula | C25H28N3O4+ |
| Molecular Weight | 434.52 g/mol |
| Exact Mass | 434.21 |
| IUPAC Name | 5-carbamoyl-2-[6-(dimethylamino)-3H-xanthen-9-yl]benzoic acid;dimethylazanium |
| SMILES | CN(C)c1ccc2c(c1)OC1=CCC=CC1=C2c1ccc(C(N)=O)cc1C(=O)O.C[NH2+]C |
| InChI | InChI=1S/C23H20N2O4.C2H7N/c1-25(2)14-8-10-17-20(12-14)29-19-6-4-3-5-16(19)21(17)15-9-7-13(22(24)26)11-18(15)23(27)28;1-3-2/h3,5-12H,4H2,1-2H3,(H2,24,26)(H,27,28);3H,1-2H3/p+1 |
| InChIKey | ZGADOXFDINYKEW-UHFFFAOYSA-O |
| XLogP | 2.40 |
| TPSA | 109.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.52 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'} |
|---|