C37H35ClN6O5 — CID 143553304
4-[[4-[(2-amino-6-chloropyrimidin-4-yl)oxymethyl]phenyl]methylcarbamoyl]-2-[3,6-bis(dimethylamino)-3H-xanthen-9-yl]benzoic acid (PubChem CID 143553304) has the molecular formula C37H35ClN6O5 and a molecular weight of 679.18 g/mol. Its IUPAC name is 4-[[4-[(2-amino-6-chloropyrimidin-4-yl)oxymethyl]phenyl]methylcarbamoyl]-2-[3,6-bis(dimethylamino)-3H-xanthen-9-yl]benzoic acid.
| Compound Name | 4-[[4-[(2-amino-6-chloropyrimidin-4-yl)oxymethyl]phenyl]methylcarbamoyl]-2-[3,6-bis(dimethylamino)-3H-xanthen-9-yl]benzoic acid |
|---|---|
| PubChem CID | 143553304 |
| Molecular Formula | C37H35ClN6O5 |
| Molecular Weight | 679.18 g/mol |
| Exact Mass | 678.24 |
| IUPAC Name | 4-[[4-[(2-amino-6-chloropyrimidin-4-yl)oxymethyl]phenyl]methylcarbamoyl]-2-[3,6-bis(dimethylamino)-3H-xanthen-9-yl]benzoic acid |
| SMILES | CN(C)c1ccc2c(c1)OC1=CC(N(C)C)C=CC1=C2c1cc(C(=O)NCc2ccc(COc3cc(Cl)nc(N)n3)cc2)ccc1C(=O)O |
| InChI | InChI=1S/C37H35ClN6O5/c1-43(2)24-10-13-27-30(16-24)49-31-17-25(44(3)4)11-14-28(31)34(27)29-15-23(9-12-26(29)36(46)47)35(45)40-19-21-5-7-22(8-6-21)20-48-33-18-32(38)41-37(39)42-33/h5-18,24H,19-20H2,1-4H3,(H,40,45)(H,46,47)(H2,39,41,42) |
| InChIKey | GWKYAGLHICEJPI-UHFFFAOYSA-N |
| XLogP | 5.56 |
| TPSA | 143.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 679.18 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'} |
|---|