C26H20NO7+ — CID 172576581
2-[3-(3-carboxyazetidin-1-ium-1-ylidene)-6-methylxanthen-9-yl]terephthalic acid (PubChem CID 172576581) has the molecular formula C26H20NO7+ and a molecular weight of 458.45 g/mol. Its IUPAC name is 2-[3-(3-carboxyazetidin-1-ium-1-ylidene)-6-methylxanthen-9-yl]terephthalic acid.
| Compound Name | 2-[3-(3-carboxyazetidin-1-ium-1-ylidene)-6-methylxanthen-9-yl]terephthalic acid |
|---|---|
| PubChem CID | 172576581 |
| Molecular Formula | C26H20NO7+ |
| Molecular Weight | 458.45 g/mol |
| Exact Mass | 458.12 |
| IUPAC Name | 2-[3-(3-carboxyazetidin-1-ium-1-ylidene)-6-methylxanthen-9-yl]terephthalic acid |
| SMILES | Cc1ccc2c(-c3cc(C(=O)O)ccc3C(=O)O)c3ccc(=[N+]4CC(C(=O)O)C4)cc-3oc2c1 |
| InChI | InChI=1S/C26H19NO7/c1-13-2-5-18-21(8-13)34-22-10-16(27-11-15(12-27)25(30)31)4-7-19(22)23(18)20-9-14(24(28)29)3-6-17(20)26(32)33/h2-10,15H,11-12H2,1H3,(H2-,28,29,30,31,32,33)/p+1/b27-16- |
| InChIKey | OVEVDJNSPPNYLZ-YUMHPJSZSA-O |
| XLogP | 3.40 |
| TPSA | 128.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.45 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|