C30H26N2O7 — CID 140772601
2-[3-[3-(carboxymethyl)azetidin-1-ium-1-ylidene]-6-[3-(carboxymethyl)azetidin-1-yl]xanthen-9-yl]benzoate (PubChem CID 140772601) has the molecular formula C30H26N2O7 and a molecular weight of 526.55 g/mol. Its IUPAC name is 2-[3-[3-(carboxymethyl)azetidin-1-ium-1-ylidene]-6-[3-(carboxymethyl)azetidin-1-yl]xanthen-9-yl]benzoate.
| Compound Name | 2-[3-[3-(carboxymethyl)azetidin-1-ium-1-ylidene]-6-[3-(carboxymethyl)azetidin-1-yl]xanthen-9-yl]benzoate |
|---|---|
| PubChem CID | 140772601 |
| Molecular Formula | C30H26N2O7 |
| Molecular Weight | 526.55 g/mol |
| Exact Mass | 526.17 |
| IUPAC Name | 2-[3-[3-(carboxymethyl)azetidin-1-ium-1-ylidene]-6-[3-(carboxymethyl)azetidin-1-yl]xanthen-9-yl]benzoate |
| SMILES | O=C(O)CC1CN(c2ccc3c(-c4ccccc4C(=O)[O-])c4ccc(=[N+]5CC(CC(=O)O)C5)cc-4oc3c2)C1 |
| InChI | InChI=1S/C30H26N2O7/c33-27(34)9-17-13-31(14-17)19-5-7-23-25(11-19)39-26-12-20(32-15-18(16-32)10-28(35)36)6-8-24(26)29(23)21-3-1-2-4-22(21)30(37)38/h1-8,11-12,17-18H,9-10,13-16H2,(H2-,33,34,35,36,37,38) |
| InChIKey | FYHSJUFURIDRBK-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 134.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.55 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|