C27H19F5N2O3 — CID 162450269
2,3,5-trifluoro-6-[3-(3-fluoroazetidin-1-ium-1-ylidene)-6-(3-fluoroazetidin-1-yl)xanthen-9-yl]-4-methylbenzoate (PubChem CID 162450269) has the molecular formula C27H19F5N2O3 and a molecular weight of 514.45 g/mol. Its IUPAC name is 2,3,5-trifluoro-6-[3-(3-fluoroazetidin-1-ium-1-ylidene)-6-(3-fluoroazetidin-1-yl)xanthen-9-yl]-4-methylbenzoate.
| Compound Name | 2,3,5-trifluoro-6-[3-(3-fluoroazetidin-1-ium-1-ylidene)-6-(3-fluoroazetidin-1-yl)xanthen-9-yl]-4-methylbenzoate |
|---|---|
| PubChem CID | 162450269 |
| Molecular Formula | C27H19F5N2O3 |
| Molecular Weight | 514.45 g/mol |
| Exact Mass | 514.13 |
| IUPAC Name | 2,3,5-trifluoro-6-[3-(3-fluoroazetidin-1-ium-1-ylidene)-6-(3-fluoroazetidin-1-yl)xanthen-9-yl]-4-methylbenzoate |
| SMILES | Cc1c(F)c(F)c(C(=O)[O-])c(-c2c3ccc(=[N+]4CC(F)C4)cc-3oc3cc(N4CC(F)C4)ccc23)c1F |
| InChI | InChI=1S/C27H19F5N2O3/c1-12-24(30)22(23(27(35)36)26(32)25(12)31)21-17-4-2-15(33-8-13(28)9-33)6-19(17)37-20-7-16(3-5-18(20)21)34-10-14(29)11-34/h2-7,13-14H,8-11H2,1H3 |
| InChIKey | NRTMNXXCCMONOB-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 59.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.45 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|