C18H25ClN2O4 — CID 163391609
methyl 3-chloro-4-[4-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]piperazin-1-yl]benzoate (PubChem CID 163391609) has the molecular formula C18H25ClN2O4 and a molecular weight of 368.86 g/mol. Its IUPAC name is methyl 3-chloro-4-[4-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]piperazin-1-yl]benzoate.
| Compound Name | methyl 3-chloro-4-[4-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]piperazin-1-yl]benzoate |
|---|---|
| PubChem CID | 163391609 |
| Molecular Formula | C18H25ClN2O4 |
| Molecular Weight | 368.86 g/mol |
| Exact Mass | 368.15 |
| IUPAC Name | methyl 3-chloro-4-[4-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]piperazin-1-yl]benzoate |
| SMILES | COC(=O)c1ccc(N2CCN(CC(=O)OC(C)(C)C)CC2)c(Cl)c1 |
| InChI | InChI=1S/C18H25ClN2O4/c1-18(2,3)25-16(22)12-20-7-9-21(10-8-20)15-6-5-13(11-14(15)19)17(23)24-4/h5-6,11H,7-10,12H2,1-4H3 |
| InChIKey | RUPMQRPDKKXSSB-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.86 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |