C38H42N2O7 — CID 91865179
2-[(3Z)-3-[2-(3-oxobutoxy)piperidin-1-ium-1-ylidene]-6-[2-(3-oxobutoxy)piperidin-1-yl]xanthen-9-yl]benzoate (PubChem CID 91865179) has the molecular formula C38H42N2O7 and a molecular weight of 638.76 g/mol. Its IUPAC name is 2-[(3Z)-3-[2-(3-oxobutoxy)piperidin-1-ium-1-ylidene]-6-[2-(3-oxobutoxy)piperidin-1-yl]xanthen-9-yl]benzoate.
| Compound Name | 2-[(3Z)-3-[2-(3-oxobutoxy)piperidin-1-ium-1-ylidene]-6-[2-(3-oxobutoxy)piperidin-1-yl]xanthen-9-yl]benzoate |
|---|---|
| PubChem CID | 91865179 |
| Molecular Formula | C38H42N2O7 |
| Molecular Weight | 638.76 g/mol |
| Exact Mass | 638.30 |
| IUPAC Name | 2-[(3Z)-3-[2-(3-oxobutoxy)piperidin-1-ium-1-ylidene]-6-[2-(3-oxobutoxy)piperidin-1-yl]xanthen-9-yl]benzoate |
| SMILES | CC(=O)CCOC1CCCCN1c1ccc2c(-c3ccccc3C(=O)[O-])c3cc/c(=[N+]4\CCCCC4OCCC(C)=O)cc-3oc2c1 |
| InChI | InChI=1S/C38H42N2O7/c1-25(41)17-21-45-35-11-5-7-19-39(35)27-13-15-31-33(23-27)47-34-24-28(40-20-8-6-12-36(40)46-22-18-26(2)42)14-16-32(34)37(31)29-9-3-4-10-30(29)38(43)44/h3-4,9-10,13-16,23-24,35-36H,5-8,11-12,17-22H2,1-2H3 |
| InChIKey | HCLUXDNRNDVNPL-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 112.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 638.76 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|