C22H18BrN2O3+ — CID 149406399
[9-(4-bromo-2-carboxyphenyl)-6-(methylamino)xanthen-3-ylidene]-methylazanium (PubChem CID 149406399) has the molecular formula C22H18BrN2O3+ and a molecular weight of 438.30 g/mol. Its IUPAC name is [9-(4-bromo-2-carboxyphenyl)-6-(methylamino)xanthen-3-ylidene]-methylazanium.
| Compound Name | [9-(4-bromo-2-carboxyphenyl)-6-(methylamino)xanthen-3-ylidene]-methylazanium |
|---|---|
| PubChem CID | 149406399 |
| Molecular Formula | C22H18BrN2O3+ |
| Molecular Weight | 438.30 g/mol |
| Exact Mass | 437.05 |
| IUPAC Name | [9-(4-bromo-2-carboxyphenyl)-6-(methylamino)xanthen-3-ylidene]-methylazanium |
| SMILES | CNc1ccc2c(-c3ccc(Br)cc3C(=O)O)c3cc/c(=[NH+]\C)cc-3oc2c1 |
| InChI | InChI=1S/C22H17BrN2O3/c1-24-13-4-7-16-19(10-13)28-20-11-14(25-2)5-8-17(20)21(16)15-6-3-12(23)9-18(15)22(26)27/h3-11,24H,1-2H3,(H,26,27)/p+1/b25-14+ |
| InChIKey | YQJNFWOYZPTQCJ-AFUMVMLFSA-O |
| XLogP | 3.32 |
| TPSA | 76.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.30 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|