C40H43N2O4+ — CID 102166653
[9-[4-(7-butoxy-2-oxochromen-3-yl)phenyl]-6-(diethylamino)xanthen-3-ylidene]-diethylazanium (PubChem CID 102166653) has the molecular formula C40H43N2O4+ and a molecular weight of 615.79 g/mol. Its IUPAC name is [9-[4-(7-butoxy-2-oxochromen-3-yl)phenyl]-6-(diethylamino)xanthen-3-ylidene]-diethylazanium.
| Compound Name | [9-[4-(7-butoxy-2-oxochromen-3-yl)phenyl]-6-(diethylamino)xanthen-3-ylidene]-diethylazanium |
|---|---|
| PubChem CID | 102166653 |
| Molecular Formula | C40H43N2O4+ |
| Molecular Weight | 615.79 g/mol |
| Exact Mass | 615.32 |
| IUPAC Name | [9-[4-(7-butoxy-2-oxochromen-3-yl)phenyl]-6-(diethylamino)xanthen-3-ylidene]-diethylazanium |
| SMILES | CCCCOc1ccc2cc(-c3ccc(-c4c5ccc(=[N+](CC)CC)cc-5oc5cc(N(CC)CC)ccc45)cc3)c(=O)oc2c1 |
| InChI | InChI=1S/C40H43N2O4/c1-6-11-22-44-32-19-16-29-23-35(40(43)46-36(29)26-32)27-12-14-28(15-13-27)39-33-20-17-30(41(7-2)8-3)24-37(33)45-38-25-31(18-21-34(38)39)42(9-4)10-5/h12-21,23-26H,6-11,22H2,1-5H3/q+1 |
| InChIKey | YKDUUFUXCZWEJU-UHFFFAOYSA-N |
| XLogP | 8.82 |
| TPSA | 58.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 615.79 |
| LogP ≤ 5 | 8.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|