C29H32ClN4O3+ — CID 122385776
[6-amino-9-[3-(morpholin-4-ylmethyl)phenyl]xanthen-3-ylidene]-[2-[(2-chloroacetyl)amino]ethyl]-methylazanium (PubChem CID 122385776) has the molecular formula C29H32ClN4O3+ and a molecular weight of 520.05 g/mol. Its IUPAC name is [6-amino-9-[3-(morpholin-4-ylmethyl)phenyl]xanthen-3-ylidene]-[2-[(2-chloroacetyl)amino]ethyl]-methylazanium.
| Compound Name | [6-amino-9-[3-(morpholin-4-ylmethyl)phenyl]xanthen-3-ylidene]-[2-[(2-chloroacetyl)amino]ethyl]-methylazanium |
|---|---|
| PubChem CID | 122385776 |
| Molecular Formula | C29H32ClN4O3+ |
| Molecular Weight | 520.05 g/mol |
| Exact Mass | 519.22 |
| IUPAC Name | [6-amino-9-[3-(morpholin-4-ylmethyl)phenyl]xanthen-3-ylidene]-[2-[(2-chloroacetyl)amino]ethyl]-methylazanium |
| SMILES | C/[N+](CCNC(=O)CCl)=c1/ccc2c(-c3cccc(CN4CCOCC4)c3)c3ccc(N)cc3oc-2c1 |
| InChI | InChI=1S/C29H31ClN4O3/c1-33(10-9-32-28(35)18-30)23-6-8-25-27(17-23)37-26-16-22(31)5-7-24(26)29(25)21-4-2-3-20(15-21)19-34-11-13-36-14-12-34/h2-8,15-17,31H,9-14,18-19H2,1H3,(H,32,35)/p+1 |
| InChIKey | YOYMBHIJZICKMV-UHFFFAOYSA-O |
| XLogP | 3.38 |
| TPSA | 83.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.05 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|