C31H35N3O8 — CID 175408161
acetic acid;methyl 2-[4-[3-(dimethylamino)-6-methyliminoxanthen-9-yl]-2-methoxy-N-(2-methoxy-2-oxoethyl)anilino]acetate (PubChem CID 175408161) has the molecular formula C31H35N3O8 and a molecular weight of 577.63 g/mol. Its IUPAC name is acetic acid;methyl 2-[4-[3-(dimethylamino)-6-methyliminoxanthen-9-yl]-2-methoxy-N-(2-methoxy-2-oxoethyl)anilino]acetate.
| Compound Name | acetic acid;methyl 2-[4-[3-(dimethylamino)-6-methyliminoxanthen-9-yl]-2-methoxy-N-(2-methoxy-2-oxoethyl)anilino]acetate |
|---|---|
| PubChem CID | 175408161 |
| Molecular Formula | C31H35N3O8 |
| Molecular Weight | 577.63 g/mol |
| Exact Mass | 577.24 |
| IUPAC Name | acetic acid;methyl 2-[4-[3-(dimethylamino)-6-methyliminoxanthen-9-yl]-2-methoxy-N-(2-methoxy-2-oxoethyl)anilino]acetate |
| SMILES | C/N=c1\ccc2c(-c3ccc(N(CC(=O)OC)CC(=O)OC)c(OC)c3)c3ccc(N(C)C)cc3oc-2c1.CC(=O)O |
| InChI | InChI=1S/C29H31N3O6.C2H4O2/c1-30-19-8-10-21-24(14-19)38-25-15-20(31(2)3)9-11-22(25)29(21)18-7-12-23(26(13-18)35-4)32(16-27(33)36-5)17-28(34)37-6;1-2(3)4/h7-15H,16-17H2,1-6H3;1H3,(H,3,4)/b30-19+; |
| InChIKey | RXGJKXKFDGTGCU-QUIZVCAPSA-N |
| XLogP | 4.05 |
| TPSA | 131.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.63 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|