C35H28N4O5 — CID 159118065
5-[3-[4-[(4-aminopyrimidin-2-yl)oxymethyl]phenyl]propanoyl]-2-(3-imino-6-methylxanthen-9-yl)benzoic acid (PubChem CID 159118065) has the molecular formula C35H28N4O5 and a molecular weight of 584.63 g/mol. Its IUPAC name is 5-[3-[4-[(4-aminopyrimidin-2-yl)oxymethyl]phenyl]propanoyl]-2-(3-imino-6-methylxanthen-9-yl)benzoic acid.
| Compound Name | 5-[3-[4-[(4-aminopyrimidin-2-yl)oxymethyl]phenyl]propanoyl]-2-(3-imino-6-methylxanthen-9-yl)benzoic acid |
|---|---|
| PubChem CID | 159118065 |
| Molecular Formula | C35H28N4O5 |
| Molecular Weight | 584.63 g/mol |
| Exact Mass | 584.21 |
| IUPAC Name | 5-[3-[4-[(4-aminopyrimidin-2-yl)oxymethyl]phenyl]propanoyl]-2-(3-imino-6-methylxanthen-9-yl)benzoic acid |
| SMILES | [H]/N=c1\ccc2c(-c3ccc(C(=O)CCc4ccc(COc5nccc(N)n5)cc4)cc3C(=O)O)c3ccc(C)cc3oc-2c1 |
| InChI | InChI=1S/C35H28N4O5/c1-20-2-10-26-30(16-20)44-31-18-24(36)9-12-27(31)33(26)25-11-8-23(17-28(25)34(41)42)29(40)13-7-21-3-5-22(6-4-21)19-43-35-38-15-14-32(37)39-35/h2-6,8-12,14-18,36H,7,13,19H2,1H3,(H,41,42)(H2,37,38,39)/b36-24+ |
| InChIKey | SRRSYAKFLMDCDR-XBQJKBNESA-N |
| XLogP | 6.46 |
| TPSA | 152.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.63 |
| LogP ≤ 5 | 6.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|