C31H29N2O3+ — CID 162019975
[7-anilino-9-(2-carboxyphenyl)-6-methylxanthen-3-ylidene]-diethylazanium (PubChem CID 162019975) has the molecular formula C31H29N2O3+ and a molecular weight of 477.58 g/mol. Its IUPAC name is [7-anilino-9-(2-carboxyphenyl)-6-methylxanthen-3-ylidene]-diethylazanium.
| Compound Name | [7-anilino-9-(2-carboxyphenyl)-6-methylxanthen-3-ylidene]-diethylazanium |
|---|---|
| PubChem CID | 162019975 |
| Molecular Formula | C31H29N2O3+ |
| Molecular Weight | 477.58 g/mol |
| Exact Mass | 477.22 |
| IUPAC Name | [7-anilino-9-(2-carboxyphenyl)-6-methylxanthen-3-ylidene]-diethylazanium |
| SMILES | CC[N+](CC)=c1ccc2c(-c3ccccc3C(=O)O)c3cc(Nc4ccccc4)c(C)cc3oc-2c1 |
| InChI | InChI=1S/C31H28N2O3/c1-4-33(5-2)22-15-16-25-29(18-22)36-28-17-20(3)27(32-21-11-7-6-8-12-21)19-26(28)30(25)23-13-9-10-14-24(23)31(34)35/h6-19,32H,4-5H2,1-3H3/p+1 |
| InChIKey | XIJQYIBXTRVJFL-UHFFFAOYSA-O |
| XLogP | 6.77 |
| TPSA | 65.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.58 |
| LogP ≤ 5 | 6.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|