C32H30F2NO10P — CID 143051102
2-(2,7-difluoro-3-hydroxy-6-oxoxanthen-9-yl)-4-[(3-ethenyl-3-ethyl-6-phosphonooxyhept-5-enyl)carbamoyl]benzoic acid (PubChem CID 143051102) has the molecular formula C32H30F2NO10P and a molecular weight of 657.56 g/mol. Its IUPAC name is 2-(2,7-difluoro-3-hydroxy-6-oxoxanthen-9-yl)-4-[(3-ethenyl-3-ethyl-6-phosphonooxyhept-5-enyl)carbamoyl]benzoic acid.
| Compound Name | 2-(2,7-difluoro-3-hydroxy-6-oxoxanthen-9-yl)-4-[(3-ethenyl-3-ethyl-6-phosphonooxyhept-5-enyl)carbamoyl]benzoic acid |
|---|---|
| PubChem CID | 143051102 |
| Molecular Formula | C32H30F2NO10P |
| Molecular Weight | 657.56 g/mol |
| Exact Mass | 657.16 |
| IUPAC Name | 2-(2,7-difluoro-3-hydroxy-6-oxoxanthen-9-yl)-4-[(3-ethenyl-3-ethyl-6-phosphonooxyhept-5-enyl)carbamoyl]benzoic acid |
| SMILES | C=CC(CC)(CC=C(C)OP(=O)(O)O)CCNC(=O)c1ccc(C(=O)O)c(-c2c3cc(F)c(=O)cc-3oc3cc(O)c(F)cc23)c1 |
| InChI | InChI=1S/C32H30F2NO10P/c1-4-32(5-2,9-8-17(3)45-46(41,42)43)10-11-35-30(38)18-6-7-19(31(39)40)20(12-18)29-21-13-23(33)25(36)15-27(21)44-28-16-26(37)24(34)14-22(28)29/h4,6-8,12-16,36H,1,5,9-11H2,2-3H3,(H,35,38)(H,39,40)(H2,41,42,43) |
| InChIKey | FDGLXYIJRDLURP-UHFFFAOYSA-N |
| XLogP | 6.35 |
| TPSA | 183.60 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 657.56 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|