C29H22BCl2NO7 — CID 101426803
2-[4-[[(2-boronophenyl)methyl-methylamino]methyl]-2,7-dichloro-3-hydroxy-6-oxoxanthen-9-yl]benzoic acid (PubChem CID 101426803) has the molecular formula C29H22BCl2NO7 and a molecular weight of 578.21 g/mol. Its IUPAC name is 2-[4-[[(2-boronophenyl)methyl-methylamino]methyl]-2,7-dichloro-3-hydroxy-6-oxoxanthen-9-yl]benzoic acid.
| Compound Name | 2-[4-[[(2-boronophenyl)methyl-methylamino]methyl]-2,7-dichloro-3-hydroxy-6-oxoxanthen-9-yl]benzoic acid |
|---|---|
| PubChem CID | 101426803 |
| Molecular Formula | C29H22BCl2NO7 |
| Molecular Weight | 578.21 g/mol |
| Exact Mass | 577.09 |
| IUPAC Name | 2-[4-[[(2-boronophenyl)methyl-methylamino]methyl]-2,7-dichloro-3-hydroxy-6-oxoxanthen-9-yl]benzoic acid |
| SMILES | CN(Cc1ccccc1B(O)O)Cc1c(O)c(Cl)cc2c(-c3ccccc3C(=O)O)c3cc(Cl)c(=O)cc-3oc12 |
| InChI | InChI=1S/C29H22BCl2NO7/c1-33(13-15-6-2-5-9-21(15)30(38)39)14-20-27(35)23(32)11-19-26(16-7-3-4-8-17(16)29(36)37)18-10-22(31)24(34)12-25(18)40-28(19)20/h2-12,35,38-39H,13-14H2,1H3,(H,36,37) |
| InChIKey | BTWSMQLWCYMZMS-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 131.44 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.21 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|