C48H40Cl2N6O5 — CID 90846172
2-[2,7-dichloro-4,5-bis[(1,3-dipyridin-2-ylpropan-2-ylamino)methyl]-3-hydroxy-6-oxoxanthen-9-yl]benzoic acid (PubChem CID 90846172) has the molecular formula C48H40Cl2N6O5 and a molecular weight of 851.79 g/mol. Its IUPAC name is 2-[2,7-dichloro-4,5-bis[(1,3-dipyridin-2-ylpropan-2-ylamino)methyl]-3-hydroxy-6-oxoxanthen-9-yl]benzoic acid.
| Compound Name | 2-[2,7-dichloro-4,5-bis[(1,3-dipyridin-2-ylpropan-2-ylamino)methyl]-3-hydroxy-6-oxoxanthen-9-yl]benzoic acid |
|---|---|
| PubChem CID | 90846172 |
| Molecular Formula | C48H40Cl2N6O5 |
| Molecular Weight | 851.79 g/mol |
| Exact Mass | 850.24 |
| IUPAC Name | 2-[2,7-dichloro-4,5-bis[(1,3-dipyridin-2-ylpropan-2-ylamino)methyl]-3-hydroxy-6-oxoxanthen-9-yl]benzoic acid |
| SMILES | O=C(O)c1ccccc1-c1c2cc(Cl)c(=O)c(CNC(Cc3ccccn3)Cc3ccccn3)c-2oc2c(CNC(Cc3ccccn3)Cc3ccccn3)c(O)c(Cl)cc12 |
| InChI | InChI=1S/C48H40Cl2N6O5/c49-41-25-37-43(35-15-1-2-16-36(35)48(59)60)38-26-42(50)45(58)40(28-56-34(23-31-13-5-9-19-53-31)24-32-14-6-10-20-54-32)47(38)61-46(37)39(44(41)57)27-55-33(21-29-11-3-7-17-51-29)22-30-12-4-8-18-52-30/h1-20,25-26,33-34,55-57H,21-24,27-28H2,(H,59,60) |
| InChIKey | WIFGKRKFNNTBPO-UHFFFAOYSA-N |
| XLogP | 8.74 |
| TPSA | 163.36 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 61 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 851.79 |
| LogP ≤ 5 | 8.74 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|