C26H28Cl2N6O5 — CID 102053354
2-[4,5-bis[[bis(aminomethyl)amino]methyl]-2,7-dichloro-3-hydroxy-6-oxoxanthen-9-yl]benzoic acid (PubChem CID 102053354) has the molecular formula C26H28Cl2N6O5 and a molecular weight of 575.45 g/mol. Its IUPAC name is 2-[4,5-bis[[bis(aminomethyl)amino]methyl]-2,7-dichloro-3-hydroxy-6-oxoxanthen-9-yl]benzoic acid.
| Compound Name | 2-[4,5-bis[[bis(aminomethyl)amino]methyl]-2,7-dichloro-3-hydroxy-6-oxoxanthen-9-yl]benzoic acid |
|---|---|
| PubChem CID | 102053354 |
| Molecular Formula | C26H28Cl2N6O5 |
| Molecular Weight | 575.45 g/mol |
| Exact Mass | 574.15 |
| IUPAC Name | 2-[4,5-bis[[bis(aminomethyl)amino]methyl]-2,7-dichloro-3-hydroxy-6-oxoxanthen-9-yl]benzoic acid |
| SMILES | NCN(CN)Cc1c2oc3c(CN(CN)CN)c(O)c(Cl)cc3c(-c3ccccc3C(=O)O)c-2cc(Cl)c1=O |
| InChI | InChI=1S/C26H28Cl2N6O5/c27-19-5-15-21(13-3-1-2-4-14(13)26(37)38)16-6-20(28)23(36)18(8-34(11-31)12-32)25(16)39-24(15)17(22(19)35)7-33(9-29)10-30/h1-6,35H,7-12,29-32H2,(H,37,38) |
| InChIKey | CGGMJGCSKHJNOU-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 198.30 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.45 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|