C44H40Cl2N2O7 — CID 102331975
2-[2,7-dichloro-3-hydroxy-4,5-bis[(4-hydroxy-4-phenylpiperidin-1-yl)methyl]-6-oxoxanthen-9-yl]benzoic acid (PubChem CID 102331975) has the molecular formula C44H40Cl2N2O7 and a molecular weight of 779.72 g/mol. Its IUPAC name is 2-[2,7-dichloro-3-hydroxy-4,5-bis[(4-hydroxy-4-phenylpiperidin-1-yl)methyl]-6-oxoxanthen-9-yl]benzoic acid.
| Compound Name | 2-[2,7-dichloro-3-hydroxy-4,5-bis[(4-hydroxy-4-phenylpiperidin-1-yl)methyl]-6-oxoxanthen-9-yl]benzoic acid |
|---|---|
| PubChem CID | 102331975 |
| Molecular Formula | C44H40Cl2N2O7 |
| Molecular Weight | 779.72 g/mol |
| Exact Mass | 778.22 |
| IUPAC Name | 2-[2,7-dichloro-3-hydroxy-4,5-bis[(4-hydroxy-4-phenylpiperidin-1-yl)methyl]-6-oxoxanthen-9-yl]benzoic acid |
| SMILES | O=C(O)c1ccccc1-c1c2cc(Cl)c(=O)c(CN3CCC(O)(c4ccccc4)CC3)c-2oc2c(CN3CCC(O)(c4ccccc4)CC3)c(O)c(Cl)cc12 |
| InChI | InChI=1S/C44H40Cl2N2O7/c45-35-23-31-37(29-13-7-8-14-30(29)42(51)52)32-24-36(46)39(50)34(26-48-21-17-44(54,18-22-48)28-11-5-2-6-12-28)41(32)55-40(31)33(38(35)49)25-47-19-15-43(53,16-20-47)27-9-3-1-4-10-27/h1-14,23-24,49,53-54H,15-22,25-26H2,(H,51,52) |
| InChIKey | XRLHRSMFMCPCJA-UHFFFAOYSA-N |
| XLogP | 8.24 |
| TPSA | 134.68 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 779.72 |
| LogP ≤ 5 | 8.24 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|