C28H32O5 — CID 170607515
ethane;2-(3-hydroxy-2,4,5,7-tetramethyl-6-oxoxanthen-9-yl)benzoic acid (PubChem CID 170607515) has the molecular formula C28H32O5 and a molecular weight of 448.56 g/mol. Its IUPAC name is ethane;2-(3-hydroxy-2,4,5,7-tetramethyl-6-oxoxanthen-9-yl)benzoic acid.
| Compound Name | ethane;2-(3-hydroxy-2,4,5,7-tetramethyl-6-oxoxanthen-9-yl)benzoic acid |
|---|---|
| PubChem CID | 170607515 |
| Molecular Formula | C28H32O5 |
| Molecular Weight | 448.56 g/mol |
| Exact Mass | 448.22 |
| IUPAC Name | ethane;2-(3-hydroxy-2,4,5,7-tetramethyl-6-oxoxanthen-9-yl)benzoic acid |
| SMILES | CC.CC.Cc1cc2c(-c3ccccc3C(=O)O)c3cc(C)c(=O)c(C)c-3oc2c(C)c1O |
| InChI | InChI=1S/C24H20O5.2C2H6/c1-11-9-17-19(15-7-5-6-8-16(15)24(27)28)18-10-12(2)21(26)14(4)23(18)29-22(17)13(3)20(11)25;2*1-2/h5-10,25H,1-4H3,(H,27,28);2*1-2H3 |
| InChIKey | GTBIHZAYHWOYIN-UHFFFAOYSA-N |
| XLogP | 7.25 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.56 |
| LogP ≤ 5 | 7.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|