C19H16O6 — CID 13288116
2-(2,3-dimethoxyphenyl)-3-methyl-4-oxochromene-8-carboxylic acid (PubChem CID 13288116) has the molecular formula C19H16O6 and a molecular weight of 340.33 g/mol. Its IUPAC name is 2-(2,3-dimethoxyphenyl)-3-methyl-4-oxochromene-8-carboxylic acid.
| Compound Name | 2-(2,3-dimethoxyphenyl)-3-methyl-4-oxochromene-8-carboxylic acid |
|---|---|
| PubChem CID | 13288116 |
| Molecular Formula | C19H16O6 |
| Molecular Weight | 340.33 g/mol |
| Exact Mass | 340.09 |
| IUPAC Name | 2-(2,3-dimethoxyphenyl)-3-methyl-4-oxochromene-8-carboxylic acid |
| SMILES | COc1cccc(-c2oc3c(C(=O)O)cccc3c(=O)c2C)c1OC |
| InChI | InChI=1S/C19H16O6/c1-10-15(20)11-6-4-8-13(19(21)22)17(11)25-16(10)12-7-5-9-14(23-2)18(12)24-3/h4-9H,1-3H3,(H,21,22) |
| InChIKey | AAVYMPQPEONHMH-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 85.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.33 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |