C27H25Cl3N2O4 — CID 143603431
N-(2-aminoethyl)-2,4,5-trichloro-6-(3-hydroxy-2,4,5,7-tetramethyl-6-oxoxanthen-9-yl)-3-methylbenzamide (PubChem CID 143603431) has the molecular formula C27H25Cl3N2O4 and a molecular weight of 547.87 g/mol. Its IUPAC name is N-(2-aminoethyl)-2,4,5-trichloro-6-(3-hydroxy-2,4,5,7-tetramethyl-6-oxoxanthen-9-yl)-3-methylbenzamide.
| Compound Name | N-(2-aminoethyl)-2,4,5-trichloro-6-(3-hydroxy-2,4,5,7-tetramethyl-6-oxoxanthen-9-yl)-3-methylbenzamide |
|---|---|
| PubChem CID | 143603431 |
| Molecular Formula | C27H25Cl3N2O4 |
| Molecular Weight | 547.87 g/mol |
| Exact Mass | 546.09 |
| IUPAC Name | N-(2-aminoethyl)-2,4,5-trichloro-6-(3-hydroxy-2,4,5,7-tetramethyl-6-oxoxanthen-9-yl)-3-methylbenzamide |
| SMILES | Cc1cc2c(-c3c(Cl)c(Cl)c(C)c(Cl)c3C(=O)NCCN)c3cc(C)c(=O)c(C)c-3oc2c(C)c1O |
| InChI | InChI=1S/C27H25Cl3N2O4/c1-10-8-15-17(18-19(27(35)32-7-6-31)20(28)12(3)21(29)22(18)30)16-9-11(2)24(34)14(5)26(16)36-25(15)13(4)23(10)33/h8-9,33H,6-7,31H2,1-5H3,(H,32,35) |
| InChIKey | OPMJVHLCFAKEKC-UHFFFAOYSA-N |
| XLogP | 6.46 |
| TPSA | 105.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.87 |
| LogP ≤ 5 | 6.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|