C8H8Cl3N3O — CID 86720558
N-(2-aminoethyl)-2,4,6-trichloropyridine-3-carboxamide (PubChem CID 86720558) has the molecular formula C8H8Cl3N3O and a molecular weight of 268.53 g/mol. Its IUPAC name is N-(2-aminoethyl)-2,4,6-trichloropyridine-3-carboxamide.
| Compound Name | N-(2-aminoethyl)-2,4,6-trichloropyridine-3-carboxamide |
|---|---|
| PubChem CID | 86720558 |
| Molecular Formula | C8H8Cl3N3O |
| Molecular Weight | 268.53 g/mol |
| Exact Mass | 266.97 |
| IUPAC Name | N-(2-aminoethyl)-2,4,6-trichloropyridine-3-carboxamide |
| SMILES | NCCNC(=O)c1c(Cl)cc(Cl)nc1Cl |
| InChI | InChI=1S/C8H8Cl3N3O/c9-4-3-5(10)14-7(11)6(4)8(15)13-2-1-12/h3H,1-2,12H2,(H,13,15) |
| InChIKey | QMIRJURJBTWBAQ-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.53 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|