C8H6Cl3NO — CID 167053835
1-(2,4,6-trichloro-3-pyridinyl)propan-1-one (PubChem CID 167053835) has the molecular formula C8H6Cl3NO and a molecular weight of 238.50 g/mol. Its IUPAC name is 1-(2,4,6-trichloro-3-pyridinyl)propan-1-one.
| Compound Name | 1-(2,4,6-trichloro-3-pyridinyl)propan-1-one |
|---|---|
| PubChem CID | 167053835 |
| Molecular Formula | C8H6Cl3NO |
| Molecular Weight | 238.50 g/mol |
| Exact Mass | 236.95 |
| IUPAC Name | 1-(2,4,6-trichloro-3-pyridinyl)propan-1-one |
| SMILES | CCC(=O)c1c(Cl)cc(Cl)nc1Cl |
| InChI | InChI=1S/C8H6Cl3NO/c1-2-5(13)7-4(9)3-6(10)12-8(7)11/h3H,2H2,1H3 |
| InChIKey | QKNXKBQFXKPWBR-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.50 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|