C44H34F2N4O5S2 — CID 102150206
2-[2,7-difluoro-3-hydroxy-6-oxo-4,5-bis[[pyridin-2-ylmethyl(thiophen-2-ylmethyl)amino]methyl]xanthen-9-yl]benzoic acid (PubChem CID 102150206) has the molecular formula C44H34F2N4O5S2 and a molecular weight of 800.91 g/mol. Its IUPAC name is 2-[2,7-difluoro-3-hydroxy-6-oxo-4,5-bis[[pyridin-2-ylmethyl(thiophen-2-ylmethyl)amino]methyl]xanthen-9-yl]benzoic acid.
| Compound Name | 2-[2,7-difluoro-3-hydroxy-6-oxo-4,5-bis[[pyridin-2-ylmethyl(thiophen-2-ylmethyl)amino]methyl]xanthen-9-yl]benzoic acid |
|---|---|
| PubChem CID | 102150206 |
| Molecular Formula | C44H34F2N4O5S2 |
| Molecular Weight | 800.91 g/mol |
| Exact Mass | 800.19 |
| IUPAC Name | 2-[2,7-difluoro-3-hydroxy-6-oxo-4,5-bis[[pyridin-2-ylmethyl(thiophen-2-ylmethyl)amino]methyl]xanthen-9-yl]benzoic acid |
| SMILES | O=C(O)c1ccccc1-c1c2cc(F)c(=O)c(CN(Cc3ccccn3)Cc3cccs3)c-2oc2c(CN(Cc3ccccn3)Cc3cccs3)c(O)c(F)cc12 |
| InChI | InChI=1S/C44H34F2N4O5S2/c45-37-19-33-39(31-13-1-2-14-32(31)44(53)54)34-20-38(46)41(52)36(26-50(24-30-12-8-18-57-30)22-28-10-4-6-16-48-28)43(34)55-42(33)35(40(37)51)25-49(23-29-11-7-17-56-29)21-27-9-3-5-15-47-27/h1-20,51H,21-26H2,(H,53,54) |
| InChIKey | HVCSTDJECSJUEU-UHFFFAOYSA-N |
| XLogP | 9.56 |
| TPSA | 120.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 800.91 |
| LogP ≤ 5 | 9.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|