C25H21N3O6 — CID 86305672
7-acetyloxy-8-[[bis(pyridin-2-ylmethyl)amino]methyl]-2-oxochromene-3-carboxylic acid (PubChem CID 86305672) has the molecular formula C25H21N3O6 and a molecular weight of 459.46 g/mol. Its IUPAC name is 7-acetyloxy-8-[[bis(pyridin-2-ylmethyl)amino]methyl]-2-oxochromene-3-carboxylic acid.
| Compound Name | 7-acetyloxy-8-[[bis(pyridin-2-ylmethyl)amino]methyl]-2-oxochromene-3-carboxylic acid |
|---|---|
| PubChem CID | 86305672 |
| Molecular Formula | C25H21N3O6 |
| Molecular Weight | 459.46 g/mol |
| Exact Mass | 459.14 |
| IUPAC Name | 7-acetyloxy-8-[[bis(pyridin-2-ylmethyl)amino]methyl]-2-oxochromene-3-carboxylic acid |
| SMILES | CC(=O)Oc1ccc2cc(C(=O)O)c(=O)oc2c1CN(Cc1ccccn1)Cc1ccccn1 |
| InChI | InChI=1S/C25H21N3O6/c1-16(29)33-22-9-8-17-12-20(24(30)31)25(32)34-23(17)21(22)15-28(13-18-6-2-4-10-26-18)14-19-7-3-5-11-27-19/h2-12H,13-15H2,1H3,(H,30,31) |
| InChIKey | QZVAYIQLQPVDRD-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 122.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.46 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|