C15H15FO5 — CID 86637436
7-(2-fluoroethoxy)-2-oxo-8-propylchromene-3-carboxylic acid (PubChem CID 86637436) has the molecular formula C15H15FO5 and a molecular weight of 294.28 g/mol. Its IUPAC name is 7-(2-fluoroethoxy)-2-oxo-8-propylchromene-3-carboxylic acid.
| Compound Name | 7-(2-fluoroethoxy)-2-oxo-8-propylchromene-3-carboxylic acid |
|---|---|
| PubChem CID | 86637436 |
| Molecular Formula | C15H15FO5 |
| Molecular Weight | 294.28 g/mol |
| Exact Mass | 294.09 |
| IUPAC Name | 7-(2-fluoroethoxy)-2-oxo-8-propylchromene-3-carboxylic acid |
| SMILES | CCCc1c(OCCF)ccc2cc(C(=O)O)c(=O)oc12 |
| InChI | InChI=1S/C15H15FO5/c1-2-3-10-12(20-7-6-16)5-4-9-8-11(14(17)18)15(19)21-13(9)10/h4-5,8H,2-3,6-7H2,1H3,(H,17,18) |
| InChIKey | FZLUWFVEERURHM-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 76.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.28 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|