C22H24N2O4 — CID 24763189
N-[4-(aminomethyl)-3-methylphenyl]-7-methoxy-2-oxo-8-propylchromene-3-carboxamide (PubChem CID 24763189) has the molecular formula C22H24N2O4 and a molecular weight of 380.44 g/mol. Its IUPAC name is N-[4-(aminomethyl)-3-methylphenyl]-7-methoxy-2-oxo-8-propylchromene-3-carboxamide.
| Compound Name | N-[4-(aminomethyl)-3-methylphenyl]-7-methoxy-2-oxo-8-propylchromene-3-carboxamide |
|---|---|
| PubChem CID | 24763189 |
| Molecular Formula | C22H24N2O4 |
| Molecular Weight | 380.44 g/mol |
| Exact Mass | 380.17 |
| IUPAC Name | N-[4-(aminomethyl)-3-methylphenyl]-7-methoxy-2-oxo-8-propylchromene-3-carboxamide |
| SMILES | CCCc1c(OC)ccc2cc(C(=O)Nc3ccc(CN)c(C)c3)c(=O)oc12 |
| InChI | InChI=1S/C22H24N2O4/c1-4-5-17-19(27-3)9-7-14-11-18(22(26)28-20(14)17)21(25)24-16-8-6-15(12-23)13(2)10-16/h6-11H,4-5,12,23H2,1-3H3,(H,24,25) |
| InChIKey | LHZFBFVODMHDCN-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 94.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.44 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|