C23H26N2O6 — CID 87589202
N-[4-[(1S,2S)-2-amino-3-hydroxy-1-methoxypropyl]phenyl]-8-ethyl-7-methoxy-2-oxochromene-3-carboxamide (PubChem CID 87589202) has the molecular formula C23H26N2O6 and a molecular weight of 426.47 g/mol. Its IUPAC name is N-[4-[(1S,2S)-2-amino-3-hydroxy-1-methoxypropyl]phenyl]-8-ethyl-7-methoxy-2-oxochromene-3-carboxamide.
| Compound Name | N-[4-[(1S,2S)-2-amino-3-hydroxy-1-methoxypropyl]phenyl]-8-ethyl-7-methoxy-2-oxochromene-3-carboxamide |
|---|---|
| PubChem CID | 87589202 |
| Molecular Formula | C23H26N2O6 |
| Molecular Weight | 426.47 g/mol |
| Exact Mass | 426.18 |
| IUPAC Name | N-[4-[(1S,2S)-2-amino-3-hydroxy-1-methoxypropyl]phenyl]-8-ethyl-7-methoxy-2-oxochromene-3-carboxamide |
| SMILES | CCc1c(OC)ccc2cc(C(=O)Nc3ccc([C@H](OC)[C@@H](N)CO)cc3)c(=O)oc12 |
| InChI | InChI=1S/C23H26N2O6/c1-4-16-19(29-2)10-7-14-11-17(23(28)31-20(14)16)22(27)25-15-8-5-13(6-9-15)21(30-3)18(24)12-26/h5-11,18,21,26H,4,12,24H2,1-3H3,(H,25,27)/t18-,21-/m0/s1 |
| InChIKey | LLPGUZDFVYAVGS-RXVVDRJESA-N |
| XLogP | 2.62 |
| TPSA | 124.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.47 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|