C21H22N2O6 — CID 87589006
N-[4-(2-amino-1-hydroxyethyl)phenyl]-8-ethoxy-7-methoxy-2-oxochromene-3-carboxamide (PubChem CID 87589006) has the molecular formula C21H22N2O6 and a molecular weight of 398.42 g/mol. Its IUPAC name is N-[4-(2-amino-1-hydroxyethyl)phenyl]-8-ethoxy-7-methoxy-2-oxochromene-3-carboxamide.
| Compound Name | N-[4-(2-amino-1-hydroxyethyl)phenyl]-8-ethoxy-7-methoxy-2-oxochromene-3-carboxamide |
|---|---|
| PubChem CID | 87589006 |
| Molecular Formula | C21H22N2O6 |
| Molecular Weight | 398.42 g/mol |
| Exact Mass | 398.15 |
| IUPAC Name | N-[4-(2-amino-1-hydroxyethyl)phenyl]-8-ethoxy-7-methoxy-2-oxochromene-3-carboxamide |
| SMILES | CCOc1c(OC)ccc2cc(C(=O)Nc3ccc(C(O)CN)cc3)c(=O)oc12 |
| InChI | InChI=1S/C21H22N2O6/c1-3-28-19-17(27-2)9-6-13-10-15(21(26)29-18(13)19)20(25)23-14-7-4-12(5-8-14)16(24)11-22/h4-10,16,24H,3,11,22H2,1-2H3,(H,23,25) |
| InChIKey | JSHNQJCPTBAPHW-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 124.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.42 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|