C24H26N2O6 — CID 87679955
N-[4-[[acetyl(methyl)amino]methyl]phenyl]-7-methoxy-2-oxo-8-propan-2-yloxychromene-3-carboxamide (PubChem CID 87679955) has the molecular formula C24H26N2O6 and a molecular weight of 438.48 g/mol. Its IUPAC name is N-[4-[[acetyl(methyl)amino]methyl]phenyl]-7-methoxy-2-oxo-8-propan-2-yloxychromene-3-carboxamide.
| Compound Name | N-[4-[[acetyl(methyl)amino]methyl]phenyl]-7-methoxy-2-oxo-8-propan-2-yloxychromene-3-carboxamide |
|---|---|
| PubChem CID | 87679955 |
| Molecular Formula | C24H26N2O6 |
| Molecular Weight | 438.48 g/mol |
| Exact Mass | 438.18 |
| IUPAC Name | N-[4-[[acetyl(methyl)amino]methyl]phenyl]-7-methoxy-2-oxo-8-propan-2-yloxychromene-3-carboxamide |
| SMILES | COc1ccc2cc(C(=O)Nc3ccc(CN(C)C(C)=O)cc3)c(=O)oc2c1OC(C)C |
| InChI | InChI=1S/C24H26N2O6/c1-14(2)31-22-20(30-5)11-8-17-12-19(24(29)32-21(17)22)23(28)25-18-9-6-16(7-10-18)13-26(4)15(3)27/h6-12,14H,13H2,1-5H3,(H,25,28) |
| InChIKey | OEFMXRRDZUDKSZ-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 98.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.48 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|