C21H22N2O7S — CID 52931843
7-methoxy-N-(2-methyl-4-sulfamoylphenyl)-2-oxo-8-propan-2-yloxychromene-3-carboxamide (PubChem CID 52931843) has the molecular formula C21H22N2O7S and a molecular weight of 446.48 g/mol. Its IUPAC name is 7-methoxy-N-(2-methyl-4-sulfamoylphenyl)-2-oxo-8-propan-2-yloxychromene-3-carboxamide.
| Compound Name | 7-methoxy-N-(2-methyl-4-sulfamoylphenyl)-2-oxo-8-propan-2-yloxychromene-3-carboxamide |
|---|---|
| PubChem CID | 52931843 |
| Molecular Formula | C21H22N2O7S |
| Molecular Weight | 446.48 g/mol |
| Exact Mass | 446.11 |
| IUPAC Name | 7-methoxy-N-(2-methyl-4-sulfamoylphenyl)-2-oxo-8-propan-2-yloxychromene-3-carboxamide |
| SMILES | COc1ccc2cc(C(=O)Nc3ccc(S(N)(=O)=O)cc3C)c(=O)oc2c1OC(C)C |
| InChI | InChI=1S/C21H22N2O7S/c1-11(2)29-19-17(28-4)8-5-13-10-15(21(25)30-18(13)19)20(24)23-16-7-6-14(9-12(16)3)31(22,26)27/h5-11H,1-4H3,(H,23,24)(H2,22,26,27) |
| InChIKey | TYMTVCVZIZRYCD-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 137.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.48 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|