C20H20N2O7S — CID 52931842
8-ethoxy-7-methoxy-N-(2-methyl-4-sulfamoylphenyl)-2-oxochromene-3-carboxamide (PubChem CID 52931842) has the molecular formula C20H20N2O7S and a molecular weight of 432.45 g/mol. Its IUPAC name is 8-ethoxy-7-methoxy-N-(2-methyl-4-sulfamoylphenyl)-2-oxochromene-3-carboxamide.
| Compound Name | 8-ethoxy-7-methoxy-N-(2-methyl-4-sulfamoylphenyl)-2-oxochromene-3-carboxamide |
|---|---|
| PubChem CID | 52931842 |
| Molecular Formula | C20H20N2O7S |
| Molecular Weight | 432.45 g/mol |
| Exact Mass | 432.10 |
| IUPAC Name | 8-ethoxy-7-methoxy-N-(2-methyl-4-sulfamoylphenyl)-2-oxochromene-3-carboxamide |
| SMILES | CCOc1c(OC)ccc2cc(C(=O)Nc3ccc(S(N)(=O)=O)cc3C)c(=O)oc12 |
| InChI | InChI=1S/C20H20N2O7S/c1-4-28-18-16(27-3)8-5-12-10-14(20(24)29-17(12)18)19(23)22-15-7-6-13(9-11(15)2)30(21,25)26/h5-10H,4H2,1-3H3,(H,22,23)(H2,21,25,26) |
| InChIKey | HCYBNWMYOVXHEN-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 137.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.45 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|