C22H24N2O6S — CID 52932243
N-[4-(methanesulfonamido)-2-methylphenyl]-7-methoxy-2-oxo-8-propylchromene-3-carboxamide (PubChem CID 52932243) has the molecular formula C22H24N2O6S and a molecular weight of 444.51 g/mol. Its IUPAC name is N-[4-(methanesulfonamido)-2-methylphenyl]-7-methoxy-2-oxo-8-propylchromene-3-carboxamide.
| Compound Name | N-[4-(methanesulfonamido)-2-methylphenyl]-7-methoxy-2-oxo-8-propylchromene-3-carboxamide |
|---|---|
| PubChem CID | 52932243 |
| Molecular Formula | C22H24N2O6S |
| Molecular Weight | 444.51 g/mol |
| Exact Mass | 444.14 |
| IUPAC Name | N-[4-(methanesulfonamido)-2-methylphenyl]-7-methoxy-2-oxo-8-propylchromene-3-carboxamide |
| SMILES | CCCc1c(OC)ccc2cc(C(=O)Nc3ccc(NS(C)(=O)=O)cc3C)c(=O)oc12 |
| InChI | InChI=1S/C22H24N2O6S/c1-5-6-16-19(29-3)10-7-14-12-17(22(26)30-20(14)16)21(25)23-18-9-8-15(11-13(18)2)24-31(4,27)28/h7-12,24H,5-6H2,1-4H3,(H,23,25) |
| InChIKey | WORBNZQIKVAUHD-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 114.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.51 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|