C22H24N2O5 — CID 87590541
N-[4-(2-amino-1-hydroxyethyl)phenyl]-7-methoxy-2-oxo-8-propylchromene-3-carboxamide (PubChem CID 87590541) has the molecular formula C22H24N2O5 and a molecular weight of 396.44 g/mol. Its IUPAC name is N-[4-(2-amino-1-hydroxyethyl)phenyl]-7-methoxy-2-oxo-8-propylchromene-3-carboxamide.
| Compound Name | N-[4-(2-amino-1-hydroxyethyl)phenyl]-7-methoxy-2-oxo-8-propylchromene-3-carboxamide |
|---|---|
| PubChem CID | 87590541 |
| Molecular Formula | C22H24N2O5 |
| Molecular Weight | 396.44 g/mol |
| Exact Mass | 396.17 |
| IUPAC Name | N-[4-(2-amino-1-hydroxyethyl)phenyl]-7-methoxy-2-oxo-8-propylchromene-3-carboxamide |
| SMILES | CCCc1c(OC)ccc2cc(C(=O)Nc3ccc(C(O)CN)cc3)c(=O)oc12 |
| InChI | InChI=1S/C22H24N2O5/c1-3-4-16-19(28-2)10-7-14-11-17(22(27)29-20(14)16)21(26)24-15-8-5-13(6-9-15)18(25)12-23/h5-11,18,25H,3-4,12,23H2,1-2H3,(H,24,26) |
| InChIKey | NASCBYOINOFEQH-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 114.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.44 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|