C25H28N2O5 — CID 87684672
N-[4-[[(3R)-3-hydroxypyrrolidin-1-yl]methyl]phenyl]-7-methoxy-2-oxo-8-propylchromene-3-carboxamide (PubChem CID 87684672) has the molecular formula C25H28N2O5 and a molecular weight of 436.51 g/mol. Its IUPAC name is N-[4-[[(3R)-3-hydroxypyrrolidin-1-yl]methyl]phenyl]-7-methoxy-2-oxo-8-propylchromene-3-carboxamide.
| Compound Name | N-[4-[[(3R)-3-hydroxypyrrolidin-1-yl]methyl]phenyl]-7-methoxy-2-oxo-8-propylchromene-3-carboxamide |
|---|---|
| PubChem CID | 87684672 |
| Molecular Formula | C25H28N2O5 |
| Molecular Weight | 436.51 g/mol |
| Exact Mass | 436.20 |
| IUPAC Name | N-[4-[[(3R)-3-hydroxypyrrolidin-1-yl]methyl]phenyl]-7-methoxy-2-oxo-8-propylchromene-3-carboxamide |
| SMILES | CCCc1c(OC)ccc2cc(C(=O)Nc3ccc(CN4CC[C@@H](O)C4)cc3)c(=O)oc12 |
| InChI | InChI=1S/C25H28N2O5/c1-3-4-20-22(31-2)10-7-17-13-21(25(30)32-23(17)20)24(29)26-18-8-5-16(6-9-18)14-27-12-11-19(28)15-27/h5-10,13,19,28H,3-4,11-12,14-15H2,1-2H3,(H,26,29)/t19-/m1/s1 |
| InChIKey | JKCJPUCEJDCQEA-LJQANCHMSA-N |
| XLogP | 3.57 |
| TPSA | 92.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.51 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|