C23H24N2O4 — CID 87690725
N-[4-(2-aminopropan-2-yl)phenyl]-7-methoxy-2-oxo-8-prop-2-enylchromene-3-carboxamide (PubChem CID 87690725) has the molecular formula C23H24N2O4 and a molecular weight of 392.46 g/mol. Its IUPAC name is N-[4-(2-aminopropan-2-yl)phenyl]-7-methoxy-2-oxo-8-prop-2-enylchromene-3-carboxamide.
| Compound Name | N-[4-(2-aminopropan-2-yl)phenyl]-7-methoxy-2-oxo-8-prop-2-enylchromene-3-carboxamide |
|---|---|
| PubChem CID | 87690725 |
| Molecular Formula | C23H24N2O4 |
| Molecular Weight | 392.46 g/mol |
| Exact Mass | 392.17 |
| IUPAC Name | N-[4-(2-aminopropan-2-yl)phenyl]-7-methoxy-2-oxo-8-prop-2-enylchromene-3-carboxamide |
| SMILES | C=CCc1c(OC)ccc2cc(C(=O)Nc3ccc(C(C)(C)N)cc3)c(=O)oc12 |
| InChI | InChI=1S/C23H24N2O4/c1-5-6-17-19(28-4)12-7-14-13-18(22(27)29-20(14)17)21(26)25-16-10-8-15(9-11-16)23(2,3)24/h5,7-13H,1,6,24H2,2-4H3,(H,25,26) |
| InChIKey | YNXZCIQPPKEXHF-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 94.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.46 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'coumarin_B(2)', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|