C12H10Cl2N2O3S2 — CID 107965296
2,5-dichloro-N-(2-methyl-4-sulfamoylphenyl)thiophene-3-carboxamide (PubChem CID 107965296) has the molecular formula C12H10Cl2N2O3S2 and a molecular weight of 365.26 g/mol. Its IUPAC name is 2,5-dichloro-N-(2-methyl-4-sulfamoylphenyl)thiophene-3-carboxamide.
| Compound Name | 2,5-dichloro-N-(2-methyl-4-sulfamoylphenyl)thiophene-3-carboxamide |
|---|---|
| PubChem CID | 107965296 |
| Molecular Formula | C12H10Cl2N2O3S2 |
| Molecular Weight | 365.26 g/mol |
| Exact Mass | 363.95 |
| IUPAC Name | 2,5-dichloro-N-(2-methyl-4-sulfamoylphenyl)thiophene-3-carboxamide |
| SMILES | Cc1cc(S(N)(=O)=O)ccc1NC(=O)c1cc(Cl)sc1Cl |
| InChI | InChI=1S/C12H10Cl2N2O3S2/c1-6-4-7(21(15,18)19)2-3-9(6)16-12(17)8-5-10(13)20-11(8)14/h2-5H,1H3,(H,16,17)(H2,15,18,19) |
| InChIKey | YPDODDMYQREBET-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 89.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.26 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |