C38H33F2N3O5S — CID 101370249
2-[4-[[2-[[2-ethylsulfanylethyl(pyridin-2-ylmethyl)amino]methyl]anilino]methyl]-2,7-difluoro-3-hydroxy-6-oxoxanthen-9-yl]benzoic acid (PubChem CID 101370249) has the molecular formula C38H33F2N3O5S and a molecular weight of 681.76 g/mol. Its IUPAC name is 2-[4-[[2-[[2-ethylsulfanylethyl(pyridin-2-ylmethyl)amino]methyl]anilino]methyl]-2,7-difluoro-3-hydroxy-6-oxoxanthen-9-yl]benzoic acid.
| Compound Name | 2-[4-[[2-[[2-ethylsulfanylethyl(pyridin-2-ylmethyl)amino]methyl]anilino]methyl]-2,7-difluoro-3-hydroxy-6-oxoxanthen-9-yl]benzoic acid |
|---|---|
| PubChem CID | 101370249 |
| Molecular Formula | C38H33F2N3O5S |
| Molecular Weight | 681.76 g/mol |
| Exact Mass | 681.21 |
| IUPAC Name | 2-[4-[[2-[[2-ethylsulfanylethyl(pyridin-2-ylmethyl)amino]methyl]anilino]methyl]-2,7-difluoro-3-hydroxy-6-oxoxanthen-9-yl]benzoic acid |
| SMILES | CCSCCN(Cc1ccccn1)Cc1ccccc1NCc1c(O)c(F)cc2c(-c3ccccc3C(=O)O)c3cc(F)c(=O)cc-3oc12 |
| InChI | InChI=1S/C38H33F2N3O5S/c1-2-49-16-15-43(22-24-10-7-8-14-41-24)21-23-9-3-6-13-32(23)42-20-29-36(45)31(40)18-28-35(25-11-4-5-12-26(25)38(46)47)27-17-30(39)33(44)19-34(27)48-37(28)29/h3-14,17-19,42,45H,2,15-16,20-22H2,1H3,(H,46,47) |
| InChIKey | PCEGJWNKXVVGIS-UHFFFAOYSA-N |
| XLogP | 8.01 |
| TPSA | 115.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 681.76 |
| LogP ≤ 5 | 8.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|