C31H21ClN2O6 — CID 24871773
2-[2-chloro-6-hydroxy-5-[[[2-(hydroxymethyl)quinolin-8-yl]amino]methyl]-3-oxoxanthen-9-yl]benzoic acid (PubChem CID 24871773) has the molecular formula C31H21ClN2O6 and a molecular weight of 552.97 g/mol. Its IUPAC name is 2-[2-chloro-6-hydroxy-5-[[[2-(hydroxymethyl)quinolin-8-yl]amino]methyl]-3-oxoxanthen-9-yl]benzoic acid.
| Compound Name | 2-[2-chloro-6-hydroxy-5-[[[2-(hydroxymethyl)quinolin-8-yl]amino]methyl]-3-oxoxanthen-9-yl]benzoic acid |
|---|---|
| PubChem CID | 24871773 |
| Molecular Formula | C31H21ClN2O6 |
| Molecular Weight | 552.97 g/mol |
| Exact Mass | 552.11 |
| IUPAC Name | 2-[2-chloro-6-hydroxy-5-[[[2-(hydroxymethyl)quinolin-8-yl]amino]methyl]-3-oxoxanthen-9-yl]benzoic acid |
| SMILES | O=C(O)c1ccccc1-c1c2cc(Cl)c(=O)cc-2oc2c(CNc3cccc4ccc(CO)nc34)c(O)ccc12 |
| InChI | InChI=1S/C31H21ClN2O6/c32-23-12-21-27(13-26(23)37)40-30-20(28(21)18-5-1-2-6-19(18)31(38)39)10-11-25(36)22(30)14-33-24-7-3-4-16-8-9-17(15-35)34-29(16)24/h1-13,33,35-36H,14-15H2,(H,38,39) |
| InChIKey | UBBNZUQSEMGXQP-UHFFFAOYSA-N |
| XLogP | 6.27 |
| TPSA | 132.89 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.97 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|