C43H29ClN2O5 — CID 24872605
2-[5-[[(2-benzyl-6-phenylquinolin-8-yl)amino]methyl]-2-chloro-6-hydroxy-3-oxoxanthen-9-yl]benzoic acid (PubChem CID 24872605) has the molecular formula C43H29ClN2O5 and a molecular weight of 689.17 g/mol. Its IUPAC name is 2-[5-[[(2-benzyl-6-phenylquinolin-8-yl)amino]methyl]-2-chloro-6-hydroxy-3-oxoxanthen-9-yl]benzoic acid.
| Compound Name | 2-[5-[[(2-benzyl-6-phenylquinolin-8-yl)amino]methyl]-2-chloro-6-hydroxy-3-oxoxanthen-9-yl]benzoic acid |
|---|---|
| PubChem CID | 24872605 |
| Molecular Formula | C43H29ClN2O5 |
| Molecular Weight | 689.17 g/mol |
| Exact Mass | 688.18 |
| IUPAC Name | 2-[5-[[(2-benzyl-6-phenylquinolin-8-yl)amino]methyl]-2-chloro-6-hydroxy-3-oxoxanthen-9-yl]benzoic acid |
| SMILES | O=C(O)c1ccccc1-c1c2cc(Cl)c(=O)cc-2oc2c(CNc3cc(-c4ccccc4)cc4ccc(Cc5ccccc5)nc34)c(O)ccc12 |
| InChI | InChI=1S/C43H29ClN2O5/c44-35-22-33-39(23-38(35)48)51-42-32(40(33)30-13-7-8-14-31(30)43(49)50)17-18-37(47)34(42)24-45-36-21-28(26-11-5-2-6-12-26)20-27-15-16-29(46-41(27)36)19-25-9-3-1-4-10-25/h1-18,20-23,45,47H,19,24H2,(H,49,50) |
| InChIKey | XBJSCBMPYKMOKV-UHFFFAOYSA-N |
| XLogP | 10.04 |
| TPSA | 112.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 689.17 |
| LogP ≤ 5 | 10.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|