C42H30Cl2N4O5 — CID 58391949
2-[4,5-bis[[(5-chloro-2-methylquinolin-8-yl)amino]methyl]-3-hydroxy-6-oxoxanthen-9-yl]benzoic acid (PubChem CID 58391949) has the molecular formula C42H30Cl2N4O5 and a molecular weight of 741.63 g/mol. Its IUPAC name is 2-[4,5-bis[[(5-chloro-2-methylquinolin-8-yl)amino]methyl]-3-hydroxy-6-oxoxanthen-9-yl]benzoic acid.
| Compound Name | 2-[4,5-bis[[(5-chloro-2-methylquinolin-8-yl)amino]methyl]-3-hydroxy-6-oxoxanthen-9-yl]benzoic acid |
|---|---|
| PubChem CID | 58391949 |
| Molecular Formula | C42H30Cl2N4O5 |
| Molecular Weight | 741.63 g/mol |
| Exact Mass | 740.16 |
| IUPAC Name | 2-[4,5-bis[[(5-chloro-2-methylquinolin-8-yl)amino]methyl]-3-hydroxy-6-oxoxanthen-9-yl]benzoic acid |
| SMILES | Cc1ccc2c(Cl)ccc(NCc3c4oc5c(CNc6ccc(Cl)c7ccc(C)nc67)c(O)ccc5c(-c5ccccc5C(=O)O)c-4ccc3=O)c2n1 |
| InChI | InChI=1S/C42H30Cl2N4O5/c1-21-7-9-25-31(43)13-15-33(38(25)47-21)45-19-29-35(49)17-11-27-37(23-5-3-4-6-24(23)42(51)52)28-12-18-36(50)30(41(28)53-40(27)29)20-46-34-16-14-32(44)26-10-8-22(2)48-39(26)34/h3-18,45-46,49H,19-20H2,1-2H3,(H,51,52) |
| InChIKey | TZMQGVAOWPHNIQ-UHFFFAOYSA-N |
| XLogP | 10.21 |
| TPSA | 137.58 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 741.63 |
| LogP ≤ 5 | 10.21 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|