C33H24N2O6 — CID 88911617
methyl 8-[[9-(2-formylphenyl)-3-hydroxy-7-methyl-6-oxoxanthen-4-yl]methylamino]quinoline-2-carboxylate (PubChem CID 88911617) has the molecular formula C33H24N2O6 and a molecular weight of 544.56 g/mol. Its IUPAC name is methyl 8-[[9-(2-formylphenyl)-3-hydroxy-7-methyl-6-oxoxanthen-4-yl]methylamino]quinoline-2-carboxylate.
| Compound Name | methyl 8-[[9-(2-formylphenyl)-3-hydroxy-7-methyl-6-oxoxanthen-4-yl]methylamino]quinoline-2-carboxylate |
|---|---|
| PubChem CID | 88911617 |
| Molecular Formula | C33H24N2O6 |
| Molecular Weight | 544.56 g/mol |
| Exact Mass | 544.16 |
| IUPAC Name | methyl 8-[[9-(2-formylphenyl)-3-hydroxy-7-methyl-6-oxoxanthen-4-yl]methylamino]quinoline-2-carboxylate |
| SMILES | COC(=O)c1ccc2cccc(NCc3c(O)ccc4c(-c5ccccc5C=O)c5cc(C)c(=O)cc-5oc34)c2n1 |
| InChI | InChI=1S/C33H24N2O6/c1-18-14-23-29(15-28(18)38)41-32-22(30(23)21-8-4-3-6-20(21)17-36)11-13-27(37)24(32)16-34-25-9-5-7-19-10-12-26(33(39)40-2)35-31(19)25/h3-15,17,34,37H,16H2,1-2H3 |
| InChIKey | NQFKNPZGROJCHD-UHFFFAOYSA-N |
| XLogP | 6.34 |
| TPSA | 118.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.56 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|