C45H32ClN5O9 — CID 123442984
2-[5-[[(2-acetylquinolin-8-yl)amino]methyl]-6-amino-2-chloro-4-[[(2-methoxycarbonylquinolin-8-yl)amino]methyl]-3-oxoxanthen-9-yl]benzoic acid;carbon dioxide (PubChem CID 123442984) has the molecular formula C45H32ClN5O9 and a molecular weight of 822.23 g/mol. Its IUPAC name is 2-[5-[[(2-acetylquinolin-8-yl)amino]methyl]-6-amino-2-chloro-4-[[(2-methoxycarbonylquinolin-8-yl)amino]methyl]-3-oxoxanthen-9-yl]benzoic acid;carbon dioxide.
| Compound Name | 2-[5-[[(2-acetylquinolin-8-yl)amino]methyl]-6-amino-2-chloro-4-[[(2-methoxycarbonylquinolin-8-yl)amino]methyl]-3-oxoxanthen-9-yl]benzoic acid;carbon dioxide |
|---|---|
| PubChem CID | 123442984 |
| Molecular Formula | C45H32ClN5O9 |
| Molecular Weight | 822.23 g/mol |
| Exact Mass | 821.19 |
| IUPAC Name | 2-[5-[[(2-acetylquinolin-8-yl)amino]methyl]-6-amino-2-chloro-4-[[(2-methoxycarbonylquinolin-8-yl)amino]methyl]-3-oxoxanthen-9-yl]benzoic acid;carbon dioxide |
| SMILES | COC(=O)c1ccc2cccc(NCc3c4oc5c(CNc6cccc7ccc(C(C)=O)nc67)c(N)ccc5c(-c5ccccc5C(=O)O)c-4cc(Cl)c3=O)c2n1.O=C=O |
| InChI | InChI=1S/C44H32ClN5O7.CO2/c1-22(51)33-17-13-23-7-5-11-34(38(23)49-33)47-20-29-32(46)16-15-27-37(25-9-3-4-10-26(25)43(53)54)28-19-31(45)40(52)30(42(28)57-41(27)29)21-48-35-12-6-8-24-14-18-36(44(55)56-2)50-39(24)35;2-1-3/h3-19,47-48H,20-21,46H2,1-2H3,(H,53,54); |
| InChIKey | PESGLVVCDJDURB-UHFFFAOYSA-N |
| XLogP | 8.22 |
| TPSA | 220.88 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 60 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 822.23 |
| LogP ≤ 5 | 8.22 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|