C42H29ClN4O7 — CID 58391996
8-[[2-chloro-3-hydroxy-9-(2-methoxycarbonylphenyl)-6-oxo-5-[(quinolin-8-ylamino)methyl]xanthen-4-yl]methylamino]quinoline-2-carboxylic acid (PubChem CID 58391996) has the molecular formula C42H29ClN4O7 and a molecular weight of 737.17 g/mol. Its IUPAC name is 8-[[2-chloro-3-hydroxy-9-(2-methoxycarbonylphenyl)-6-oxo-5-[(quinolin-8-ylamino)methyl]xanthen-4-yl]methylamino]quinoline-2-carboxylic acid.
| Compound Name | 8-[[2-chloro-3-hydroxy-9-(2-methoxycarbonylphenyl)-6-oxo-5-[(quinolin-8-ylamino)methyl]xanthen-4-yl]methylamino]quinoline-2-carboxylic acid |
|---|---|
| PubChem CID | 58391996 |
| Molecular Formula | C42H29ClN4O7 |
| Molecular Weight | 737.17 g/mol |
| Exact Mass | 736.17 |
| IUPAC Name | 8-[[2-chloro-3-hydroxy-9-(2-methoxycarbonylphenyl)-6-oxo-5-[(quinolin-8-ylamino)methyl]xanthen-4-yl]methylamino]quinoline-2-carboxylic acid |
| SMILES | COC(=O)c1ccccc1-c1c2ccc(=O)c(CNc3cccc4cccnc34)c-2oc2c(CNc3cccc4ccc(C(=O)O)nc34)c(O)c(Cl)cc12 |
| InChI | InChI=1S/C42H29ClN4O7/c1-53-42(52)25-11-3-2-10-24(25)35-26-15-17-34(48)28(20-45-31-12-4-7-22-9-6-18-44-36(22)31)39(26)54-40-27(35)19-30(43)38(49)29(40)21-46-32-13-5-8-23-14-16-33(41(50)51)47-37(23)32/h2-19,45-46,49H,20-21H2,1H3,(H,50,51) |
| InChIKey | QPCHNIHWVLMERM-UHFFFAOYSA-N |
| XLogP | 8.73 |
| TPSA | 163.88 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 737.17 |
| LogP ≤ 5 | 8.73 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|